C10H20F3NO4SSi — CID 153300358
5-[methoxy(dimethyl)silyl]-N-(trifluoromethylsulfonyl)hexanamide (PubChem CID 153300358) has the molecular formula C10H20F3NO4SSi and a molecular weight of 335.42 g/mol. Its IUPAC name is 5-[methoxy(dimethyl)silyl]-N-(trifluoromethylsulfonyl)hexanamide.
| Compound Name | 5-[methoxy(dimethyl)silyl]-N-(trifluoromethylsulfonyl)hexanamide |
|---|---|
| PubChem CID | 153300358 |
| Molecular Formula | C10H20F3NO4SSi |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 5-[methoxy(dimethyl)silyl]-N-(trifluoromethylsulfonyl)hexanamide |
| SMILES | CO[Si](C)(C)C(C)CCCC(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H20F3NO4SSi/c1-8(20(3,4)18-2)6-5-7-9(15)14-19(16,17)10(11,12)13/h8H,5-7H2,1-4H3,(H,14,15) |
| InChIKey | RQBZTQYEURCTBA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|