C9H18F3NO4SSi — CID 153300335
4-[methoxy(dimethyl)silyl]-3-methyl-N-(trifluoromethylsulfonyl)butanamide (PubChem CID 153300335) has the molecular formula C9H18F3NO4SSi and a molecular weight of 321.39 g/mol. Its IUPAC name is 4-[methoxy(dimethyl)silyl]-3-methyl-N-(trifluoromethylsulfonyl)butanamide.
| Compound Name | 4-[methoxy(dimethyl)silyl]-3-methyl-N-(trifluoromethylsulfonyl)butanamide |
|---|---|
| PubChem CID | 153300335 |
| Molecular Formula | C9H18F3NO4SSi |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 4-[methoxy(dimethyl)silyl]-3-methyl-N-(trifluoromethylsulfonyl)butanamide |
| SMILES | CO[Si](C)(C)CC(C)CC(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H18F3NO4SSi/c1-7(6-19(3,4)17-2)5-8(14)13-18(15,16)9(10,11)12/h7H,5-6H2,1-4H3,(H,13,14) |
| InChIKey | FWPHTKHWCILEPE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|