C10H20F2O6SSi — CID 153308388
1,1-difluoro-2-[4-[methoxy(dimethyl)silyl]-2-methylbutanoyl]oxyethanesulfonic acid (PubChem CID 153308388) has the molecular formula C10H20F2O6SSi and a molecular weight of 334.41 g/mol. Its IUPAC name is 1,1-difluoro-2-[4-[methoxy(dimethyl)silyl]-2-methylbutanoyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[4-[methoxy(dimethyl)silyl]-2-methylbutanoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 153308388 |
| Molecular Formula | C10H20F2O6SSi |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 1,1-difluoro-2-[4-[methoxy(dimethyl)silyl]-2-methylbutanoyl]oxyethanesulfonic acid |
| SMILES | CO[Si](C)(C)CCC(C)C(=O)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C10H20F2O6SSi/c1-8(5-6-20(3,4)17-2)9(13)18-7-10(11,12)19(14,15)16/h8H,5-7H2,1-4H3,(H,14,15,16) |
| InChIKey | YPVXQJRVCJAVTF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|