C15H25N3O5 — CID 24797021
methyl (2S)-2-[[2-(5,5-dimethyl-1,3-dioxan-2-yl)-1-hydroxyethyl]amino]-3-(1H-imidazol-5-yl)propanoate (PubChem CID 24797021) has the molecular formula C15H25N3O5 and a molecular weight of 327.38 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(5,5-dimethyl-1,3-dioxan-2-yl)-1-hydroxyethyl]amino]-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | methyl (2S)-2-[[2-(5,5-dimethyl-1,3-dioxan-2-yl)-1-hydroxyethyl]amino]-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 24797021 |
| Molecular Formula | C15H25N3O5 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | methyl (2S)-2-[[2-(5,5-dimethyl-1,3-dioxan-2-yl)-1-hydroxyethyl]amino]-3-(1H-imidazol-5-yl)propanoate |
| SMILES | COC(=O)[C@H](Cc1cnc[nH]1)NC(O)CC1OCC(C)(C)CO1 |
| InChI | InChI=1S/C15H25N3O5/c1-15(2)7-22-13(23-8-15)5-12(19)18-11(14(20)21-3)4-10-6-16-9-17-10/h6,9,11-13,18-19H,4-5,7-8H2,1-3H3,(H,16,17)/t11-,12?/m0/s1 |
| InChIKey | ONFUYGZUWMBSPT-PXYINDEMSA-N |
| XLogP | 0.19 |
| TPSA | 105.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|