About CID 24798849
CID 24798849 (PubChem CID 24798849) has the molecular formula C17H15ClFe+2
and a molecular weight of 310.61 g/mol.
Molecular Properties
| Compound Name | CID 24798849 |
| PubChem CID | 24798849 |
| Molecular Formula | C17H15ClFe+2 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | — |
| SMILES | Clc1cccc(C[C]2[CH][CH][CH][CH]2)c1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C12H10Cl.C5H5.Fe/c13-12-7-3-6-11(9-12)8-10-4-1-2-5-10;1-2-4-5-3-1;/h1-7,9H,8H2;1-5H;/q;;+2 |
| InChIKey | FSSNKZCSELGWED-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 24798849 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 24798849?
The IUPAC name of CID 24798849 (CID 24798849) is not available.
What is the SMILES notation for CID 24798849?
The canonical SMILES for CID 24798849 is Clc1cccc(C[C]2[CH][CH][CH][CH]2)c1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 24798849?
The InChIKey is FSSNKZCSELGWED-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl.C5H5.Fe/c13-12-7-3-6-11(9-12)8-10-4-1-2-5-10;1-2-4-5-3-1;/h1-7,9H,8H2;1-5H;/q;;+2.
What are the key properties of CID 24798849?
CID 24798849 has a molecular weight of 310.61 g/mol, XLogP of 4.31, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 24798849 is sourced from PubChem (CID 24798849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).