C20H24N6O3 — CID 24800321
6-methyl-2-[[2-[(1-methylpiperidin-4-yl)amino]-6-nitrobenzimidazol-1-yl]methyl]pyridin-3-ol (PubChem CID 24800321) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 6-methyl-2-[[2-[(1-methylpiperidin-4-yl)amino]-6-nitrobenzimidazol-1-yl]methyl]pyridin-3-ol.
| Compound Name | 6-methyl-2-[[2-[(1-methylpiperidin-4-yl)amino]-6-nitrobenzimidazol-1-yl]methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 24800321 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 6-methyl-2-[[2-[(1-methylpiperidin-4-yl)amino]-6-nitrobenzimidazol-1-yl]methyl]pyridin-3-ol |
| SMILES | Cc1ccc(O)c(Cn2c(NC3CCN(C)CC3)nc3ccc([N+](=O)[O-])cc32)n1 |
| InChI | InChI=1S/C20H24N6O3/c1-13-3-6-19(27)17(21-13)12-25-18-11-15(26(28)29)4-5-16(18)23-20(25)22-14-7-9-24(2)10-8-14/h3-6,11,14,27H,7-10,12H2,1-2H3,(H,22,23) |
| InChIKey | JJKNZAGFZHAJJG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|