C11H20NO+ — CID 24801545
2-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene]ethanol (PubChem CID 24801545) has the molecular formula C11H20NO+ and a molecular weight of 182.29 g/mol. Its IUPAC name is 2-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene]ethanol.
| Compound Name | 2-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene]ethanol |
|---|---|
| PubChem CID | 24801545 |
| Molecular Formula | C11H20NO+ |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 2-[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-ylidene]ethanol |
| SMILES | C[N+]1(C)[C@@H]2CC[C@H]1C/C(=C\CO)C2 |
| InChI | InChI=1S/C11H20NO/c1-12(2)10-3-4-11(12)8-9(7-10)5-6-13/h5,10-11,13H,3-4,6-8H2,1-2H3/q+1/b9-5-/t10-,11+/m1/s1 |
| InChIKey | WVYGMCOTHQHTNQ-NVIAFKCQSA-N |
| XLogP | 1.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|