C11H19NO — CID 103971446
(1Z)-1-(2,3,5,6,8,8a-hexahydro-1H-indolizin-7-ylidene)propan-2-ol (PubChem CID 103971446) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (1Z)-1-(2,3,5,6,8,8a-hexahydro-1H-indolizin-7-ylidene)propan-2-ol.
| Compound Name | (1Z)-1-(2,3,5,6,8,8a-hexahydro-1H-indolizin-7-ylidene)propan-2-ol |
|---|---|
| PubChem CID | 103971446 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (1Z)-1-(2,3,5,6,8,8a-hexahydro-1H-indolizin-7-ylidene)propan-2-ol |
| SMILES | CC(O)/C=C1/CCN2CCCC2C1 |
| InChI | InChI=1S/C11H19NO/c1-9(13)7-10-4-6-12-5-2-3-11(12)8-10/h7,9,11,13H,2-6,8H2,1H3/b10-7- |
| InChIKey | XCQSJYPUPHOMIQ-YFHOEESVSA-N |
| XLogP | 1.55 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|