C16H29NO — CID 586765
7-(8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl)hept-3-en-2-ol (PubChem CID 586765) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 7-(8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl)hept-3-en-2-ol.
| Compound Name | 7-(8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl)hept-3-en-2-ol |
|---|---|
| PubChem CID | 586765 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 7-(8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl)hept-3-en-2-ol |
| SMILES | CC(O)C=CCCCC1CCC(C)C2CCCN12 |
| InChI | InChI=1S/C16H29NO/c1-13-10-11-15(17-12-6-9-16(13)17)8-5-3-4-7-14(2)18/h4,7,13-16,18H,3,5-6,8-12H2,1-2H3 |
| InChIKey | OVCNLQUMMGZZFV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|