C18H33NO — CID 91716154
(Z)-9-(8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl)non-5-en-2-ol (PubChem CID 91716154) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is (Z)-9-(8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl)non-5-en-2-ol.
| Compound Name | (Z)-9-(8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl)non-5-en-2-ol |
|---|---|
| PubChem CID | 91716154 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | (Z)-9-(8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl)non-5-en-2-ol |
| SMILES | CC(O)CC/C=C\CCCC1CCC(C)C2CCCN12 |
| InChI | InChI=1S/C18H33NO/c1-15-12-13-17(19-14-8-11-18(15)19)10-7-5-3-4-6-9-16(2)20/h3-4,15-18,20H,5-14H2,1-2H3/b4-3- |
| InChIKey | DKWNJQWJTACGJL-ARJAWSKDSA-N |
| XLogP | 4.14 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|