C17H31NO — CID 91721043
(7Z)-6-methyl-7-(8-methyl-2,3,5,7,8,8a-hexahydro-1H-indolizin-6-ylidene)heptan-2-ol (PubChem CID 91721043) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is (7Z)-6-methyl-7-(8-methyl-2,3,5,7,8,8a-hexahydro-1H-indolizin-6-ylidene)heptan-2-ol.
| Compound Name | (7Z)-6-methyl-7-(8-methyl-2,3,5,7,8,8a-hexahydro-1H-indolizin-6-ylidene)heptan-2-ol |
|---|---|
| PubChem CID | 91721043 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | (7Z)-6-methyl-7-(8-methyl-2,3,5,7,8,8a-hexahydro-1H-indolizin-6-ylidene)heptan-2-ol |
| SMILES | CC(O)CCCC(C)/C=C1/CC(C)C2CCCN2C1 |
| InChI | InChI=1S/C17H31NO/c1-13(6-4-7-15(3)19)10-16-11-14(2)17-8-5-9-18(17)12-16/h10,13-15,17,19H,4-9,11-12H2,1-3H3/b16-10- |
| InChIKey | DRSBKRSVSKLTIP-YBEGLDIGSA-N |
| XLogP | 3.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|