C19H35NO — CID 91721005
(8Z)-4,7-dimethyl-8-(8-methyl-2,3,5,7,8,8a-hexahydro-1H-indolizin-6-ylidene)octan-3-ol (PubChem CID 91721005) has the molecular formula C19H35NO and a molecular weight of 293.50 g/mol. Its IUPAC name is (8Z)-4,7-dimethyl-8-(8-methyl-2,3,5,7,8,8a-hexahydro-1H-indolizin-6-ylidene)octan-3-ol.
| Compound Name | (8Z)-4,7-dimethyl-8-(8-methyl-2,3,5,7,8,8a-hexahydro-1H-indolizin-6-ylidene)octan-3-ol |
|---|---|
| PubChem CID | 91721005 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | (8Z)-4,7-dimethyl-8-(8-methyl-2,3,5,7,8,8a-hexahydro-1H-indolizin-6-ylidene)octan-3-ol |
| SMILES | CCC(O)C(C)CCC(C)/C=C1/CC(C)C2CCCN2C1 |
| InChI | InChI=1S/C19H35NO/c1-5-19(21)15(3)9-8-14(2)11-17-12-16(4)18-7-6-10-20(18)13-17/h11,14-16,18-19,21H,5-10,12-13H2,1-4H3/b17-11- |
| InChIKey | ZJXPTEQQYIODOP-BOPFTXTBSA-N |
| XLogP | 4.24 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|