C15H27NO2 — CID 91724243
(6Z)-6-(4-hydroxy-2-methylpentylidene)-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol (PubChem CID 91724243) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is (6Z)-6-(4-hydroxy-2-methylpentylidene)-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol.
| Compound Name | (6Z)-6-(4-hydroxy-2-methylpentylidene)-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol |
|---|---|
| PubChem CID | 91724243 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (6Z)-6-(4-hydroxy-2-methylpentylidene)-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol |
| SMILES | CC(O)CC(C)/C=C1\CN2CCCC2C(C)(O)C1 |
| InChI | InChI=1S/C15H27NO2/c1-11(7-12(2)17)8-13-9-15(3,18)14-5-4-6-16(14)10-13/h8,11-12,14,17-18H,4-7,9-10H2,1-3H3/b13-8- |
| InChIKey | YALFEJVZCJKMCD-JYRVWZFOSA-N |
| XLogP | 1.94 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|