C13H23NO — CID 177401033
(1S,3E)-3-(2-methylpropylidene)-1,2,4,6,7,8,9,9a-octahydroquinolizin-1-ol (PubChem CID 177401033) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (1S,3E)-3-(2-methylpropylidene)-1,2,4,6,7,8,9,9a-octahydroquinolizin-1-ol.
| Compound Name | (1S,3E)-3-(2-methylpropylidene)-1,2,4,6,7,8,9,9a-octahydroquinolizin-1-ol |
|---|---|
| PubChem CID | 177401033 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (1S,3E)-3-(2-methylpropylidene)-1,2,4,6,7,8,9,9a-octahydroquinolizin-1-ol |
| SMILES | CC(C)/C=C1\C[C@H](O)C2CCCCN2C1 |
| InChI | InChI=1S/C13H23NO/c1-10(2)7-11-8-13(15)12-5-3-4-6-14(12)9-11/h7,10,12-13,15H,3-6,8-9H2,1-2H3/b11-7+/t12?,13-/m0/s1 |
| InChIKey | IMHVFJSVBTVWGX-QIGDZFGJSA-N |
| XLogP | 2.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|