C13H23NO — CID 10987517
(6Z,8S,8aS)-8-methyl-6-(2-methylpropylidene)-1,2,3,5,7,8a-hexahydroindolizin-8-ol (PubChem CID 10987517) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (6Z,8S,8aS)-8-methyl-6-(2-methylpropylidene)-1,2,3,5,7,8a-hexahydroindolizin-8-ol.
| Compound Name | (6Z,8S,8aS)-8-methyl-6-(2-methylpropylidene)-1,2,3,5,7,8a-hexahydroindolizin-8-ol |
|---|---|
| PubChem CID | 10987517 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (6Z,8S,8aS)-8-methyl-6-(2-methylpropylidene)-1,2,3,5,7,8a-hexahydroindolizin-8-ol |
| SMILES | CC(C)/C=C1\CN2CCC[C@H]2[C@@](C)(O)C1 |
| InChI | InChI=1S/C13H23NO/c1-10(2)7-11-8-13(3,15)12-5-4-6-14(12)9-11/h7,10,12,15H,4-6,8-9H2,1-3H3/b11-7-/t12-,13-/m0/s1 |
| InChIKey | XAXHWNNCXDDRBC-LVRHIEOCSA-N |
| XLogP | 2.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|