C20H33NO2 — CID 101351564
(E,7R,8Z)-8-[(1S)-1-hydroxy-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-3-ylidene]-4,7-dimethyloct-4-en-2-one (PubChem CID 101351564) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is (E,7R,8Z)-8-[(1S)-1-hydroxy-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-3-ylidene]-4,7-dimethyloct-4-en-2-one.
| Compound Name | (E,7R,8Z)-8-[(1S)-1-hydroxy-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-3-ylidene]-4,7-dimethyloct-4-en-2-one |
|---|---|
| PubChem CID | 101351564 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | (E,7R,8Z)-8-[(1S)-1-hydroxy-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-3-ylidene]-4,7-dimethyloct-4-en-2-one |
| SMILES | CC(=O)C/C(C)=C/C[C@@H](C)/C=C1\CN2CCCCC2[C@@](C)(O)C1 |
| InChI | InChI=1S/C20H33NO2/c1-15(11-17(3)22)8-9-16(2)12-18-13-20(4,23)19-7-5-6-10-21(19)14-18/h8,12,16,19,23H,5-7,9-11,13-14H2,1-4H3/b15-8+,18-12-/t16-,19?,20+/m1/s1 |
| InChIKey | PPBUINQSZLYENO-YXJNWWCISA-N |
| XLogP | 3.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|