C18H14ClF3O3S — CID 24801664
2-[1-(3-chlorophenyl)-3-oxo-3-[4-(trifluoromethyl)phenyl]propyl]sulfanylacetic acid (PubChem CID 24801664) has the molecular formula C18H14ClF3O3S and a molecular weight of 402.82 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)-3-oxo-3-[4-(trifluoromethyl)phenyl]propyl]sulfanylacetic acid.
| Compound Name | 2-[1-(3-chlorophenyl)-3-oxo-3-[4-(trifluoromethyl)phenyl]propyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 24801664 |
| Molecular Formula | C18H14ClF3O3S |
| Molecular Weight | 402.82 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 2-[1-(3-chlorophenyl)-3-oxo-3-[4-(trifluoromethyl)phenyl]propyl]sulfanylacetic acid |
| SMILES | O=C(O)CSC(CC(=O)c1ccc(C(F)(F)F)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H14ClF3O3S/c19-14-3-1-2-12(8-14)16(26-10-17(24)25)9-15(23)11-4-6-13(7-5-11)18(20,21)22/h1-8,16H,9-10H2,(H,24,25) |
| InChIKey | BWGVSQGYDZQCSV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.82 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |