C14H15N7O2 — CID 24802761
2-azido-1-[4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]ethanone (PubChem CID 24802761) has the molecular formula C14H15N7O2 and a molecular weight of 313.32 g/mol. Its IUPAC name is 2-azido-1-[4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-azido-1-[4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 24802761 |
| Molecular Formula | C14H15N7O2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-azido-1-[4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]ethanone |
| SMILES | [N-]=[N+]=NCC(=O)N1CCC(c2nc(-c3ccccn3)no2)CC1 |
| InChI | InChI=1S/C14H15N7O2/c15-20-17-9-12(22)21-7-4-10(5-8-21)14-18-13(19-23-14)11-3-1-2-6-16-11/h1-3,6,10H,4-5,7-9H2 |
| InChIKey | FAYCRRMNEYJBJC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|