C17H17N7O3S — CID 58295842
2-azido-1-[4-[3-(6-methoxy-1,3-benzothiazol-2-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]ethanone (PubChem CID 58295842) has the molecular formula C17H17N7O3S and a molecular weight of 399.44 g/mol. Its IUPAC name is 2-azido-1-[4-[3-(6-methoxy-1,3-benzothiazol-2-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-azido-1-[4-[3-(6-methoxy-1,3-benzothiazol-2-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 58295842 |
| Molecular Formula | C17H17N7O3S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 2-azido-1-[4-[3-(6-methoxy-1,3-benzothiazol-2-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]ethanone |
| SMILES | COc1ccc2nc(-c3noc(C4CCN(C(=O)CN=[N+]=[N-])CC4)n3)sc2c1 |
| InChI | InChI=1S/C17H17N7O3S/c1-26-11-2-3-12-13(8-11)28-17(20-12)15-21-16(27-22-15)10-4-6-24(7-5-10)14(25)9-19-23-18/h2-3,8,10H,4-7,9H2,1H3 |
| InChIKey | IDAALWMSQMOKNA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|