C19H25N5 — CID 24803055
5,7-dimethyl-12-piperidin-1-yl-3-propyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 24803055) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is 5,7-dimethyl-12-piperidin-1-yl-3-propyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 5,7-dimethyl-12-piperidin-1-yl-3-propyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 24803055 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 5,7-dimethyl-12-piperidin-1-yl-3-propyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | CCCc1nc(C)c2c(C)nc3ccc(N4CCCCC4)nc3n12 |
| InChI | InChI=1S/C19H25N5/c1-4-8-17-21-14(3)18-13(2)20-15-9-10-16(22-19(15)24(17)18)23-11-6-5-7-12-23/h9-10H,4-8,11-12H2,1-3H3 |
| InChIKey | JCDZLXSQZZKINM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |