C12H11N5 — CID 6539018
4-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrimidin-2-amine (PubChem CID 6539018) has the molecular formula C12H11N5 and a molecular weight of 225.26 g/mol. Its IUPAC name is 4-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrimidin-2-amine.
| Compound Name | 4-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 6539018 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 4-(2-methylimidazo[1,2-a]pyridin-3-yl)pyrimidin-2-amine |
| SMILES | Cc1nc2ccccn2c1-c1ccnc(N)n1 |
| InChI | InChI=1S/C12H11N5/c1-8-11(9-5-6-14-12(13)16-9)17-7-3-2-4-10(17)15-8/h2-7H,1H3,(H2,13,14,16) |
| InChIKey | LZURCICLQQQODJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |