C21H23FN8O — CID 24803262
2-[[5-[[5-fluoro-4-[2-methyl-3-(oxan-4-yl)imidazol-4-yl]pyrimidin-2-yl]amino]-2-pyridinyl]methylamino]acetonitrile (PubChem CID 24803262) has the molecular formula C21H23FN8O and a molecular weight of 422.47 g/mol. Its IUPAC name is 2-[[5-[[5-fluoro-4-[2-methyl-3-(oxan-4-yl)imidazol-4-yl]pyrimidin-2-yl]amino]-2-pyridinyl]methylamino]acetonitrile.
| Compound Name | 2-[[5-[[5-fluoro-4-[2-methyl-3-(oxan-4-yl)imidazol-4-yl]pyrimidin-2-yl]amino]-2-pyridinyl]methylamino]acetonitrile |
|---|---|
| PubChem CID | 24803262 |
| Molecular Formula | C21H23FN8O |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-[[5-[[5-fluoro-4-[2-methyl-3-(oxan-4-yl)imidazol-4-yl]pyrimidin-2-yl]amino]-2-pyridinyl]methylamino]acetonitrile |
| SMILES | Cc1ncc(-c2nc(Nc3ccc(CNCC#N)nc3)ncc2F)n1C1CCOCC1 |
| InChI | InChI=1S/C21H23FN8O/c1-14-25-13-19(30(14)17-4-8-31-9-5-17)20-18(22)12-27-21(29-20)28-16-3-2-15(26-11-16)10-24-7-6-23/h2-3,11-13,17,24H,4-5,7-10H2,1H3,(H,27,28,29) |
| InChIKey | NWPVBJGLXUQELF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 113.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|