C19H20FN6O2+ — CID 59774766
4-[[5-fluoro-4-[2-methyl-3-(oxan-4-yl)imidazol-4-yl]pyrimidin-2-yl]amino]pyridin-1-ium-1-carbaldehyde (PubChem CID 59774766) has the molecular formula C19H20FN6O2+ and a molecular weight of 383.41 g/mol. Its IUPAC name is 4-[[5-fluoro-4-[2-methyl-3-(oxan-4-yl)imidazol-4-yl]pyrimidin-2-yl]amino]pyridin-1-ium-1-carbaldehyde.
| Compound Name | 4-[[5-fluoro-4-[2-methyl-3-(oxan-4-yl)imidazol-4-yl]pyrimidin-2-yl]amino]pyridin-1-ium-1-carbaldehyde |
|---|---|
| PubChem CID | 59774766 |
| Molecular Formula | C19H20FN6O2+ |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 4-[[5-fluoro-4-[2-methyl-3-(oxan-4-yl)imidazol-4-yl]pyrimidin-2-yl]amino]pyridin-1-ium-1-carbaldehyde |
| SMILES | Cc1ncc(-c2nc(Nc3cc[n+](C=O)cc3)ncc2F)n1C1CCOCC1 |
| InChI | InChI=1S/C19H19FN6O2/c1-13-21-11-17(26(13)15-4-8-28-9-5-15)18-16(20)10-22-19(24-18)23-14-2-6-25(12-27)7-3-14/h2-3,6-7,10-12,15H,4-5,8-9H2,1H3/p+1 |
| InChIKey | JBHQDLFTKAPEPE-UHFFFAOYSA-O |
| XLogP | 2.21 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|