C19H25NO4 — CID 24805377
[(4R,5S)-5-[(1S)-1-[hydroxy-[(1R)-1-phenylprop-2-ynyl]amino]but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 24805377) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is [(4R,5S)-5-[(1S)-1-[hydroxy-[(1R)-1-phenylprop-2-ynyl]amino]but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4R,5S)-5-[(1S)-1-[hydroxy-[(1R)-1-phenylprop-2-ynyl]amino]but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 24805377 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | [(4R,5S)-5-[(1S)-1-[hydroxy-[(1R)-1-phenylprop-2-ynyl]amino]but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | C#C[C@H](c1ccccc1)N(O)[C@@H](CC=C)[C@@H]1OC(C)(C)O[C@@H]1CO |
| InChI | InChI=1S/C19H25NO4/c1-5-10-16(18-17(13-21)23-19(3,4)24-18)20(22)15(6-2)14-11-8-7-9-12-14/h2,5,7-9,11-12,15-18,21-22H,1,10,13H2,3-4H3/t15-,16+,17-,18+/m1/s1 |
| InChIKey | GEBITKVAOIPNPN-XDNAFOTISA-N |
| XLogP | 2.51 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|