C14H18ClNO2 — CID 24805939
(Z)-2-chloro-N,N-diethyl-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 24805939) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is (Z)-2-chloro-N,N-diethyl-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-chloro-N,N-diethyl-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 24805939 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (Z)-2-chloro-N,N-diethyl-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | CCN(CC)C(=O)/C(Cl)=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H18ClNO2/c1-4-16(5-2)14(17)13(15)10-11-6-8-12(18-3)9-7-11/h6-10H,4-5H2,1-3H3/b13-10- |
| InChIKey | ALWODPUFYHPHNM-RAXLEYEMSA-N |
| XLogP | 3.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|