C19H21N5O2S2 — CID 2480836
3-tert-butyl-7-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one (PubChem CID 2480836) has the molecular formula C19H21N5O2S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 3-tert-butyl-7-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one.
| Compound Name | 3-tert-butyl-7-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 2480836 |
| Molecular Formula | C19H21N5O2S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 3-tert-butyl-7-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
| SMILES | CC(C)(C)c1nnc2sc(SCC(=O)N3CCCc4ccccc43)nn2c1=O |
| InChI | InChI=1S/C19H21N5O2S2/c1-19(2,3)15-16(26)24-17(21-20-15)28-18(22-24)27-11-14(25)23-10-6-8-12-7-4-5-9-13(12)23/h4-5,7,9H,6,8,10-11H2,1-3H3 |
| InChIKey | QWNWPEYTWPYOGT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 80.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |