C19H34O2Si — CID 24808692
trimethyl-[2-[[(1R,2R,4S)-5-methylidene-2-prop-2-enyl-1-bicyclo[2.2.2]octanyl]methoxymethoxy]ethyl]silane (PubChem CID 24808692) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is trimethyl-[2-[[(1R,2R,4S)-5-methylidene-2-prop-2-enyl-1-bicyclo[2.2.2]octanyl]methoxymethoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[(1R,2R,4S)-5-methylidene-2-prop-2-enyl-1-bicyclo[2.2.2]octanyl]methoxymethoxy]ethyl]silane |
|---|---|
| PubChem CID | 24808692 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | trimethyl-[2-[[(1R,2R,4S)-5-methylidene-2-prop-2-enyl-1-bicyclo[2.2.2]octanyl]methoxymethoxy]ethyl]silane |
| SMILES | C=CC[C@@H]1C[C@@H]2CC[C@@]1(COCOCC[Si](C)(C)C)CC2=C |
| InChI | InChI=1S/C19H34O2Si/c1-6-7-18-12-17-8-9-19(18,13-16(17)2)14-21-15-20-10-11-22(3,4)5/h6,17-18H,1-2,7-15H2,3-5H3/t17-,18+,19-/m0/s1 |
| InChIKey | DEIFREXBTJNNIL-OTWHNJEPSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|