C19H34O2Si — CID 134941572
tert-butyl-[[2-(2-methoxyethenyl)-5-methylidene-1-bicyclo[2.2.2]octanyl]methoxy]-dimethylsilane (PubChem CID 134941572) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is tert-butyl-[[2-(2-methoxyethenyl)-5-methylidene-1-bicyclo[2.2.2]octanyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[2-(2-methoxyethenyl)-5-methylidene-1-bicyclo[2.2.2]octanyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134941572 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | tert-butyl-[[2-(2-methoxyethenyl)-5-methylidene-1-bicyclo[2.2.2]octanyl]methoxy]-dimethylsilane |
| SMILES | C=C1CC2(CO[Si](C)(C)C(C)(C)C)CCC1CC2C=COC |
| InChI | InChI=1S/C19H34O2Si/c1-15-13-19(14-21-22(6,7)18(2,3)4)10-8-16(15)12-17(19)9-11-20-5/h9,11,16-17H,1,8,10,12-14H2,2-7H3 |
| InChIKey | JYYBXFAHFKWAJO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|