C26H48OSi — CID 10883989
[(1R,4aR,4bS,8aS,10aR)-4b,8,8,10a-tetramethyl-2-methylidene-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-1-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10883989) has the molecular formula C26H48OSi and a molecular weight of 404.76 g/mol. Its IUPAC name is [(1R,4aR,4bS,8aS,10aR)-4b,8,8,10a-tetramethyl-2-methylidene-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-1-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,4aR,4bS,8aS,10aR)-4b,8,8,10a-tetramethyl-2-methylidene-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-1-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10883989 |
| Molecular Formula | C26H48OSi |
| Molecular Weight | 404.76 g/mol |
| Exact Mass | 404.35 |
| IUPAC Name | [(1R,4aR,4bS,8aS,10aR)-4b,8,8,10a-tetramethyl-2-methylidene-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-1-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=C1CC[C@H]2[C@@](C)(CC[C@H]3C(C)(C)CCC[C@]23C)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48OSi/c1-19-12-13-22-25(7,20(19)18-27-28(9,10)23(2,3)4)17-14-21-24(5,6)15-11-16-26(21,22)8/h20-22H,1,11-18H2,2-10H3/t20-,21+,22+,25+,26+/m1/s1 |
| InChIKey | HFIFUTZUSBIJKY-DGTHGUPJSA-N |
| XLogP | 8.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.76 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|