C17H32O2Si — CID 25053672
[(1R,2R,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylidene-1-bicyclo[2.2.2]octanyl]methanol (PubChem CID 25053672) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is [(1R,2R,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylidene-1-bicyclo[2.2.2]octanyl]methanol.
| Compound Name | [(1R,2R,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylidene-1-bicyclo[2.2.2]octanyl]methanol |
|---|---|
| PubChem CID | 25053672 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | [(1R,2R,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylidene-1-bicyclo[2.2.2]octanyl]methanol |
| SMILES | C=C1C[C@]2(CO)CC[C@H]1C[C@H]2CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O2Si/c1-13-10-17(12-18)8-7-14(13)9-15(17)11-19-20(5,6)16(2,3)4/h14-15,18H,1,7-12H2,2-6H3/t14-,15-,17-/m0/s1 |
| InChIKey | UNRDWOQGVRKTKU-ZOBUZTSGSA-N |
| XLogP | 4.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|