C27H50O2Si — CID 58103727
[(4R,7aS)-5-[(1R,2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dimethylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methanol (PubChem CID 58103727) has the molecular formula C27H50O2Si and a molecular weight of 434.78 g/mol. Its IUPAC name is [(4R,7aS)-5-[(1R,2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dimethylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methanol.
| Compound Name | [(4R,7aS)-5-[(1R,2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dimethylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methanol |
|---|---|
| PubChem CID | 58103727 |
| Molecular Formula | C27H50O2Si |
| Molecular Weight | 434.78 g/mol |
| Exact Mass | 434.36 |
| IUPAC Name | [(4R,7aS)-5-[(1R,2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,4-dimethylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]methanol |
| SMILES | C=C1CCC2[C@H](CO)C([C@@]3(C)CC[C@H](C)C[C@@H]3CO[Si](C)(C)C(C)(C)C)CC[C@]12C |
| InChI | InChI=1S/C27H50O2Si/c1-19-12-14-27(7,21(16-19)18-29-30(8,9)25(3,4)5)24-13-15-26(6)20(2)10-11-23(26)22(24)17-28/h19,21-24,28H,2,10-18H2,1,3-9H3/t19-,21+,22-,23?,24?,26+,27-/m0/s1 |
| InChIKey | BAYAFVXNWINUIW-HDGFPSCDSA-N |
| XLogP | 7.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.78 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|