C28H23ClF3N5O6S — CID 24810289
4-amino-3-[[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-2-methylphenoxy]methyl]-N-(2-hydroxyethyl)thieno[3,2-c]pyridine-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 24810289) has the molecular formula C28H23ClF3N5O6S and a molecular weight of 650.04 g/mol. Its IUPAC name is 4-amino-3-[[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-2-methylphenoxy]methyl]-N-(2-hydroxyethyl)thieno[3,2-c]pyridine-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-amino-3-[[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-2-methylphenoxy]methyl]-N-(2-hydroxyethyl)thieno[3,2-c]pyridine-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24810289 |
| Molecular Formula | C28H23ClF3N5O6S |
| Molecular Weight | 650.04 g/mol |
| Exact Mass | 649.10 |
| IUPAC Name | 4-amino-3-[[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-2-methylphenoxy]methyl]-N-(2-hydroxyethyl)thieno[3,2-c]pyridine-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(-c2nnc(-c3ccc(Cl)cc3)o2)cc1OCc1csc2c(C(=O)NCCO)cnc(N)c12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H22ClN5O4S.C2HF3O2/c1-14-2-3-16(26-32-31-25(36-26)15-4-6-18(27)7-5-15)10-20(14)35-12-17-13-37-22-19(24(34)29-8-9-33)11-30-23(28)21(17)22;3-2(4,5)1(6)7/h2-7,10-11,13,33H,8-9,12H2,1H3,(H2,28,30)(H,29,34);(H,6,7) |
| InChIKey | UMVWDFSFXHRLQE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 173.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.04 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |