C24H19FN6O — CID 24810995
8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-phenylpurine-2,8-diamine (PubChem CID 24810995) has the molecular formula C24H19FN6O and a molecular weight of 426.46 g/mol. Its IUPAC name is 8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-phenylpurine-2,8-diamine.
| Compound Name | 8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-phenylpurine-2,8-diamine |
|---|---|
| PubChem CID | 24810995 |
| Molecular Formula | C24H19FN6O |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)-9-phenylpurine-2,8-diamine |
| SMILES | COc1ccc(Nc2ncc3nc(Nc4ccccc4F)n(-c4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C24H19FN6O/c1-32-18-13-11-16(12-14-18)27-23-26-15-21-22(30-23)31(17-7-3-2-4-8-17)24(29-21)28-20-10-6-5-9-19(20)25/h2-15H,1H3,(H,28,29)(H,26,27,30) |
| InChIKey | CCMGXJGEWZSKPA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |