C24H25FN6O — CID 24810996
9-cyclohexyl-8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)purine-2,8-diamine (PubChem CID 24810996) has the molecular formula C24H25FN6O and a molecular weight of 432.50 g/mol. Its IUPAC name is 9-cyclohexyl-8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)purine-2,8-diamine.
| Compound Name | 9-cyclohexyl-8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)purine-2,8-diamine |
|---|---|
| PubChem CID | 24810996 |
| Molecular Formula | C24H25FN6O |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 9-cyclohexyl-8-N-(2-fluorophenyl)-2-N-(4-methoxyphenyl)purine-2,8-diamine |
| SMILES | COc1ccc(Nc2ncc3nc(Nc4ccccc4F)n(C4CCCCC4)c3n2)cc1 |
| InChI | InChI=1S/C24H25FN6O/c1-32-18-13-11-16(12-14-18)27-23-26-15-21-22(30-23)31(17-7-3-2-4-8-17)24(29-21)28-20-10-6-5-9-19(20)25/h5-6,9-15,17H,2-4,7-8H2,1H3,(H,28,29)(H,26,27,30) |
| InChIKey | IPXACKINLSGATE-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |