C24H22N4S — CID 2481226
3-[[4-(2,4-dimethylphenyl)-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile (PubChem CID 2481226) has the molecular formula C24H22N4S and a molecular weight of 398.54 g/mol. Its IUPAC name is 3-[[4-(2,4-dimethylphenyl)-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile.
| Compound Name | 3-[[4-(2,4-dimethylphenyl)-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 2481226 |
| Molecular Formula | C24H22N4S |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 3-[[4-(2,4-dimethylphenyl)-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile |
| SMILES | Cc1ccc(-n2c(Cc3cccc4ccccc34)nnc2SCCC#N)c(C)c1 |
| InChI | InChI=1S/C24H22N4S/c1-17-11-12-22(18(2)15-17)28-23(26-27-24(28)29-14-6-13-25)16-20-9-5-8-19-7-3-4-10-21(19)20/h3-5,7-12,15H,6,14,16H2,1-2H3 |
| InChIKey | RFDFHXNZWLJSDA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|