C21H34N2O5Si — CID 24813132
[(3aR,4R,6aS)-2,2-dimethyl-5-[(4-nitrophenyl)methyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 24813132) has the molecular formula C21H34N2O5Si and a molecular weight of 422.60 g/mol. Its IUPAC name is [(3aR,4R,6aS)-2,2-dimethyl-5-[(4-nitrophenyl)methyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4R,6aS)-2,2-dimethyl-5-[(4-nitrophenyl)methyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 24813132 |
| Molecular Formula | C21H34N2O5Si |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [(3aR,4R,6aS)-2,2-dimethyl-5-[(4-nitrophenyl)methyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@H]2[C@H](CN(Cc3ccc([N+](=O)[O-])cc3)[C@@H]2CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C21H34N2O5Si/c1-20(2,3)29(6,7)26-14-17-19-18(27-21(4,5)28-19)13-22(17)12-15-8-10-16(11-9-15)23(24)25/h8-11,17-19H,12-14H2,1-7H3/t17-,18+,19-/m1/s1 |
| InChIKey | SLMUYNIFTWHJRA-CEXWTWQISA-N |
| XLogP | 4.32 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|