C21H36N2O3Si — CID 24813266
4-[[(3aR,4R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]methyl]aniline (PubChem CID 24813266) has the molecular formula C21H36N2O3Si and a molecular weight of 392.62 g/mol. Its IUPAC name is 4-[[(3aR,4R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]methyl]aniline.
| Compound Name | 4-[[(3aR,4R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]methyl]aniline |
|---|---|
| PubChem CID | 24813266 |
| Molecular Formula | C21H36N2O3Si |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 4-[[(3aR,4R,6aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]methyl]aniline |
| SMILES | CC1(C)O[C@H]2[C@H](CN(Cc3ccc(N)cc3)[C@@H]2CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C21H36N2O3Si/c1-20(2,3)27(6,7)24-14-17-19-18(25-21(4,5)26-19)13-23(17)12-15-8-10-16(22)11-9-15/h8-11,17-19H,12-14,22H2,1-7H3/t17-,18+,19-/m1/s1 |
| InChIKey | KRPOFCVTIUIMEA-CEXWTWQISA-N |
| XLogP | 3.99 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|