C26H42N2O3Si — CID 102068664
3-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-N,N-bis(prop-2-enyl)aniline (PubChem CID 102068664) has the molecular formula C26H42N2O3Si and a molecular weight of 458.72 g/mol. Its IUPAC name is 3-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-N,N-bis(prop-2-enyl)aniline.
| Compound Name | 3-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-N,N-bis(prop-2-enyl)aniline |
|---|---|
| PubChem CID | 102068664 |
| Molecular Formula | C26H42N2O3Si |
| Molecular Weight | 458.72 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | 3-[(3aS,4S,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-N,N-bis(prop-2-enyl)aniline |
| SMILES | C=CCN(CC=C)c1cccc([C@@H]2N[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]3OC(C)(C)O[C@H]32)c1 |
| InChI | InChI=1S/C26H42N2O3Si/c1-10-15-28(16-11-2)20-14-12-13-19(17-20)22-24-23(30-26(6,7)31-24)21(27-22)18-29-32(8,9)25(3,4)5/h10-14,17,21-24,27H,1-2,15-16,18H2,3-9H3/t21-,22+,23-,24+/m1/s1 |
| InChIKey | CMHHOOGYJNCIBD-QPXUXIHVSA-N |
| XLogP | 5.42 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.72 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|