C31H50N2O5Si — CID 102068667
tert-butyl (3aS,4S,6R,6aR)-4-[3-[bis(prop-2-enyl)amino]phenyl]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 102068667) has the molecular formula C31H50N2O5Si and a molecular weight of 558.84 g/mol. Its IUPAC name is tert-butyl (3aS,4S,6R,6aR)-4-[3-[bis(prop-2-enyl)amino]phenyl]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,4S,6R,6aR)-4-[3-[bis(prop-2-enyl)amino]phenyl]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 102068667 |
| Molecular Formula | C31H50N2O5Si |
| Molecular Weight | 558.84 g/mol |
| Exact Mass | 558.35 |
| IUPAC Name | tert-butyl (3aS,4S,6R,6aR)-4-[3-[bis(prop-2-enyl)amino]phenyl]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | C=CCN(CC=C)c1cccc([C@H]2[C@@H]3OC(C)(C)O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)N2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C31H50N2O5Si/c1-13-18-32(19-14-2)23-17-15-16-22(20-23)25-27-26(36-31(9,10)37-27)24(21-35-39(11,12)30(6,7)8)33(25)28(34)38-29(3,4)5/h13-17,20,24-27H,1-2,18-19,21H2,3-12H3/t24-,25+,26-,27+/m1/s1 |
| InChIKey | BGOVONMBXGQEPB-RAVGUYNFSA-N |
| XLogP | 7.07 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.84 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|