C17H25NO3Si — CID 10591739
(3R,3aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one (PubChem CID 10591739) has the molecular formula C17H25NO3Si and a molecular weight of 319.48 g/mol. Its IUPAC name is (3R,3aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one.
| Compound Name | (3R,3aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one |
|---|---|
| PubChem CID | 10591739 |
| Molecular Formula | C17H25NO3Si |
| Molecular Weight | 319.48 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (3R,3aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1OC(=O)N2c3ccccc3C[C@@H]12 |
| InChI | InChI=1S/C17H25NO3Si/c1-17(2,3)22(4,5)20-11-15-14-10-12-8-6-7-9-13(12)18(14)16(19)21-15/h6-9,14-15H,10-11H2,1-5H3/t14-,15-/m0/s1 |
| InChIKey | XVBZFPKEIKFIBD-GJZGRUSLSA-N |
| XLogP | 3.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|