C23H40N2O8 — CID 24813560
1-O-tert-butyl 2-O-methyl (2R,5R)-2-[(1R,2S)-1,3-dihydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-5-(2-methylprop-1-enyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 24813560) has the molecular formula C23H40N2O8 and a molecular weight of 472.58 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2R,5R)-2-[(1R,2S)-1,3-dihydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-5-(2-methylprop-1-enyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2R,5R)-2-[(1R,2S)-1,3-dihydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-5-(2-methylprop-1-enyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 24813560 |
| Molecular Formula | C23H40N2O8 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2R,5R)-2-[(1R,2S)-1,3-dihydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-5-(2-methylprop-1-enyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@]1([C@H](O)[C@H](CO)NC(=O)OC(C)(C)C)CC[C@H](C=C(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H40N2O8/c1-14(2)12-15-10-11-23(18(28)31-9,25(15)20(30)33-22(6,7)8)17(27)16(13-26)24-19(29)32-21(3,4)5/h12,15-17,26-27H,10-11,13H2,1-9H3,(H,24,29)/t15-,16+,17-,23-/m1/s1 |
| InChIKey | SYIIRQRKLJDBNJ-BMCPXHGSSA-N |
| XLogP | 2.51 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|