C17H14O4 — CID 24813858
2-methyl-4-oxo-2,3-diphenoxybut-3-enal (PubChem CID 24813858) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-methyl-4-oxo-2,3-diphenoxybut-3-enal.
| Compound Name | 2-methyl-4-oxo-2,3-diphenoxybut-3-enal |
|---|---|
| PubChem CID | 24813858 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-methyl-4-oxo-2,3-diphenoxybut-3-enal |
| SMILES | CC(C=O)(Oc1ccccc1)C(=C=O)Oc1ccccc1 |
| InChI | InChI=1S/C17H14O4/c1-17(13-19,21-15-10-6-3-7-11-15)16(12-18)20-14-8-4-2-5-9-14/h2-11,13H,1H3 |
| InChIKey | JEZOHBLUHSSLDK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|