C23H20O4 — CID 54049672
2-methyl-3-oxo-2,4-diphenoxy-4-phenylbutanal (PubChem CID 54049672) has the molecular formula C23H20O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-methyl-3-oxo-2,4-diphenoxy-4-phenylbutanal.
| Compound Name | 2-methyl-3-oxo-2,4-diphenoxy-4-phenylbutanal |
|---|---|
| PubChem CID | 54049672 |
| Molecular Formula | C23H20O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-methyl-3-oxo-2,4-diphenoxy-4-phenylbutanal |
| SMILES | CC(C=O)(Oc1ccccc1)C(=O)C(Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20O4/c1-23(17-24,27-20-15-9-4-10-16-20)22(25)21(18-11-5-2-6-12-18)26-19-13-7-3-8-14-19/h2-17,21H,1H3 |
| InChIKey | REXDKPQAMGDOSP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|