C21H23FN2O2 — CID 24817113
[3-(4-fluoroanilino)piperidin-1-yl]-(3-prop-2-enoxyphenyl)methanone (PubChem CID 24817113) has the molecular formula C21H23FN2O2 and a molecular weight of 354.43 g/mol. Its IUPAC name is [3-(4-fluoroanilino)piperidin-1-yl]-(3-prop-2-enoxyphenyl)methanone.
| Compound Name | [3-(4-fluoroanilino)piperidin-1-yl]-(3-prop-2-enoxyphenyl)methanone |
|---|---|
| PubChem CID | 24817113 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [3-(4-fluoroanilino)piperidin-1-yl]-(3-prop-2-enoxyphenyl)methanone |
| SMILES | C=CCOc1cccc(C(=O)N2CCCC(Nc3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C21H23FN2O2/c1-2-13-26-20-7-3-5-16(14-20)21(25)24-12-4-6-19(15-24)23-18-10-8-17(22)9-11-18/h2-3,5,7-11,14,19,23H,1,4,6,12-13,15H2 |
| InChIKey | GMJDMSYMEHZDAI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|