C21H26N2O4 — CID 42461601
[(3S)-3-(3,4-dimethoxyanilino)piperidin-1-yl]-(3-methoxyphenyl)methanone (PubChem CID 42461601) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is [(3S)-3-(3,4-dimethoxyanilino)piperidin-1-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [(3S)-3-(3,4-dimethoxyanilino)piperidin-1-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 42461601 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [(3S)-3-(3,4-dimethoxyanilino)piperidin-1-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCC[C@H](Nc3ccc(OC)c(OC)c3)C2)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-25-18-8-4-6-15(12-18)21(24)23-11-5-7-17(14-23)22-16-9-10-19(26-2)20(13-16)27-3/h4,6,8-10,12-13,17,22H,5,7,11,14H2,1-3H3/t17-/m0/s1 |
| InChIKey | WCOVEAIBWYASNC-KRWDZBQOSA-N |
| XLogP | 3.43 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|