C18H26N2O3 — CID 42292796
1-[(3S)-3-(3,4-dimethoxyanilino)piperidin-1-yl]pent-4-en-1-one (PubChem CID 42292796) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[(3S)-3-(3,4-dimethoxyanilino)piperidin-1-yl]pent-4-en-1-one.
| Compound Name | 1-[(3S)-3-(3,4-dimethoxyanilino)piperidin-1-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 42292796 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-[(3S)-3-(3,4-dimethoxyanilino)piperidin-1-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)N1CCC[C@H](Nc2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C18H26N2O3/c1-4-5-8-18(21)20-11-6-7-15(13-20)19-14-9-10-16(22-2)17(12-14)23-3/h4,9-10,12,15,19H,1,5-8,11,13H2,2-3H3/t15-/m0/s1 |
| InChIKey | LXYFTHQYYHELBQ-HNNXBMFYSA-N |
| XLogP | 3.07 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|