C23H25N3O5 — CID 42293253
2-[2-[(3S)-3-(3,4-dimethoxyanilino)piperidin-1-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 42293253) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-[2-[(3S)-3-(3,4-dimethoxyanilino)piperidin-1-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(3S)-3-(3,4-dimethoxyanilino)piperidin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42293253 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[2-[(3S)-3-(3,4-dimethoxyanilino)piperidin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | COc1ccc(N[C@H]2CCCN(C(=O)CN3C(=O)c4ccccc4C3=O)C2)cc1OC |
| InChI | InChI=1S/C23H25N3O5/c1-30-19-10-9-15(12-20(19)31-2)24-16-6-5-11-25(13-16)21(27)14-26-22(28)17-7-3-4-8-18(17)23(26)29/h3-4,7-10,12,16,24H,5-6,11,13-14H2,1-2H3/t16-/m0/s1 |
| InChIKey | VGJDBIKLYMKFTL-INIZCTEOSA-N |
| XLogP | 2.40 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|