C24H27N3O4 — CID 25288777
[(3R)-3-(3,4-dimethoxyanilino)piperidin-1-yl]-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone (PubChem CID 25288777) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is [(3R)-3-(3,4-dimethoxyanilino)piperidin-1-yl]-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone.
| Compound Name | [(3R)-3-(3,4-dimethoxyanilino)piperidin-1-yl]-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 25288777 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | [(3R)-3-(3,4-dimethoxyanilino)piperidin-1-yl]-(5-methyl-3-phenyl-1,2-oxazol-4-yl)methanone |
| SMILES | COc1ccc(N[C@@H]2CCCN(C(=O)c3c(-c4ccccc4)noc3C)C2)cc1OC |
| InChI | InChI=1S/C24H27N3O4/c1-16-22(23(26-31-16)17-8-5-4-6-9-17)24(28)27-13-7-10-19(15-27)25-18-11-12-20(29-2)21(14-18)30-3/h4-6,8-9,11-12,14,19,25H,7,10,13,15H2,1-3H3/t19-/m1/s1 |
| InChIKey | BPEXXWSLDCKWIC-LJQANCHMSA-N |
| XLogP | 4.38 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|