About 2-methyl-6-[3-(4-propan-2-ylanilino)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one
2-methyl-6-[3-(4-propan-2-ylanilino)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one (PubChem CID 24817179) has the molecular formula C20H28N4O2
and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-methyl-6-[3-(4-propan-2-ylanilino)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one.
Molecular Properties
| Compound Name | 2-methyl-6-[3-(4-propan-2-ylanilino)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one |
| PubChem CID | 24817179 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 2-methyl-6-[3-(4-propan-2-ylanilino)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one |
| SMILES | CC(C)c1ccc(NC2CCCN(C(=O)C3=NN(C)C(=O)CC3)C2)cc1 |
| InChI | InChI=1S/C20H28N4O2/c1-14(2)15-6-8-16(9-7-15)21-17-5-4-12-24(13-17)20(26)18-10-11-19(25)23(3)22-18/h6-9,14,17,21H,4-5,10-13H2,1-3H3 |
| InChIKey | FRMVXUPVFXRYNR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-6-[3-(4-propan-2-ylanilino)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-[3-(4-propan-2-ylanilino)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one?
The IUPAC name of 2-methyl-6-[3-(4-propan-2-ylanilino)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one (CID 24817179) is 2-methyl-6-[3-(4-propan-2-ylanilino)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one.
What is the SMILES notation for 2-methyl-6-[3-(4-propan-2-ylanilino)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one?
The canonical SMILES for 2-methyl-6-[3-(4-propan-2-ylanilino)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one is CC(C)c1ccc(NC2CCCN(C(=O)C3=NN(C)C(=O)CC3)C2)cc1.
What is the InChIKey of 2-methyl-6-[3-(4-propan-2-ylanilino)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one?
The InChIKey is FRMVXUPVFXRYNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N4O2/c1-14(2)15-6-8-16(9-7-15)21-17-5-4-12-24(13-17)20(26)18-10-11-19(25)23(3)22-18/h6-9,14,17,21H,4-5,10-13H2,1-3H3.
What are the key properties of 2-methyl-6-[3-(4-propan-2-ylanilino)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one?
2-methyl-6-[3-(4-propan-2-ylanilino)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one has a molecular weight of 356.47 g/mol, XLogP of 2.82, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-[3-(4-propan-2-ylanilino)piperidine-1-carbonyl]-4,5-dihydropyridazin-3-one is sourced from PubChem (CID 24817179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).