C21H22F4N2O7 — CID 24818195
[2-[2,4-bis(difluoromethoxy)phenyl]-2-oxoethyl] 2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 24818195) has the molecular formula C21H22F4N2O7 and a molecular weight of 490.41 g/mol. Its IUPAC name is [2-[2,4-bis(difluoromethoxy)phenyl]-2-oxoethyl] 2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [2-[2,4-bis(difluoromethoxy)phenyl]-2-oxoethyl] 2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 24818195 |
| Molecular Formula | C21H22F4N2O7 |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | [2-[2,4-bis(difluoromethoxy)phenyl]-2-oxoethyl] 2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CC1CCCCC12NC(=O)N(CC(=O)OCC(=O)c1ccc(OC(F)F)cc1OC(F)F)C2=O |
| InChI | InChI=1S/C21H22F4N2O7/c1-11-4-2-3-7-21(11)17(30)27(20(31)26-21)9-16(29)32-10-14(28)13-6-5-12(33-18(22)23)8-15(13)34-19(24)25/h5-6,8,11,18-19H,2-4,7,9-10H2,1H3,(H,26,31) |
| InChIKey | ZMHQPRUIBFKWBF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|